CAS 79467-22-4

2-(2-(aminomethyl)phenylthio)benzyl alcohol

Description:

2-(2-(Aminomethyl)phenylthio)benzyl alcohol, identified by its CAS number 79467-22-4, is an organic compound characterized by the presence of both an alcohol functional group and an amine group within its structure. This compound features a benzyl alcohol moiety, which contributes to its solubility in polar solvents, and a phenylthio group that enhances its reactivity and potential for forming various derivatives. The aminomethyl substituent introduces basic properties, allowing for interactions with acids and other electrophiles. The presence of sulfur in the thioether linkage can also impart unique chemical reactivity, making it useful in various synthetic applications. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Overall, 2-(2-(aminomethyl)phenylthio)benzyl alcohol is a versatile compound with significant implications in both organic synthesis and biological studies.

Formula: C₁₄H₁₅NOS

InChI: InChI=1/C14H15NOS/c15-9-11-5-1-3-7-13(11)17-14-8-4-2-6-12(14)10-16/h1-8,16H,9-10,15H2

SMILES: c1ccc(c(c1)CN)Sc1ccccc1CO

2-[2-(Aminomethyl)phenylthio]benzyl alcohol

CAS: 79467-22-4

Formula: C₁₄H₁₅NOS

Purity: 95%

Molecular weight: 245.3400

Ref: IN-DA003G8G