CAS 79467-24-6
:1-[4,4-bis(4-fluorophenyl)butyl]-4-{2-[(2,6-dichlorophenyl)amino]-2-oxoethyl}piperazine-2-carboxamide dihydrochloride hydrate
Description:
1-[4,4-bis(4-fluorophenyl)butyl]-4-{2-[(2,6-dichlorophenyl)amino]-2-oxoethyl}piperazine-2-carboxamide dihydrochloride hydrate, with CAS number 79467-24-6, is a synthetic chemical compound characterized by its complex structure, which includes a piperazine ring, multiple aromatic groups, and functional groups such as carboxamide and oxoethyl. This compound is typically a white to off-white solid and is soluble in water due to the presence of the dihydrochloride salt form, which enhances its solubility and bioavailability. The presence of fluorine and chlorine substituents on the aromatic rings contributes to its unique chemical properties and potential biological activity. It may exhibit pharmacological effects, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. As with many synthetic compounds, its stability, reactivity, and interactions with biological systems are influenced by its molecular structure, which can be explored further through experimental studies.
Formula:C29H34Cl4F2N4O3
InChI:InChI=1/C29H30Cl2F2N4O2.2ClH.H2O/c30-24-4-1-5-25(31)28(24)35-27(38)18-36-15-16-37(26(17-36)29(34)39)14-2-3-23(19-6-10-21(32)11-7-19)20-8-12-22(33)13-9-20;;;/h1,4-13,23,26H,2-3,14-18H2,(H2,34,39)(H,35,38);2*1H;1H2
SMILES:c1cc(c(c(c1)Cl)N=C(CN1CCN(CCCC(c2ccc(cc2)F)c2ccc(cc2)F)C(C1)C(=N)O)O)Cl.Cl.Cl.O
Synonyms:- Mioflazine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mioflazine hydrochloride
CAS:Mioflazine hydrochloride is a nucleoside transport inhibitor that acts on adenosine to improve sleep.Formula:C29H34Cl4F2N4O3Color and Shape:SolidMolecular weight:666.41
