CAS 79472-21-2

2-Thiophenecarboxylic acid, 3-(aminomethyl)-, methyl ester

Description:

2-Thiophenecarboxylic acid, 3-(aminomethyl)-, methyl ester, with the CAS number 79472-21-2, is an organic compound characterized by the presence of a thiophene ring, a carboxylic acid functional group, and an amino group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the functional groups present. The methyl ester group suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid, which may have implications for its solubility and reactivity in various solvents. The amino group can participate in hydrogen bonding and may influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the thiophene ring contributes to the compound's electronic properties, potentially allowing for interactions with biological targets. Overall, this compound's unique structure and functional groups make it a candidate for further study in fields such as pharmaceuticals and agrochemicals.

Formula: C₇H₉NO₂S

InChI: InChI=1S/C7H9NO2S/c1-10-7(9)6-5(4-8)2-3-11-6/h2-3H,4,8H2,1H3

InChI key: InChIKey=MMWQALKHHPSNNY-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(CN)C=CS1

Synonyms:

• Methyl 3-(Aminomethyl)thiophene-2-carboxylate
• 2-Thiophenecarboxylic acid, 3-(aminomethyl)-, methyl ester
• 3-Aminomethyl-thiophene-2-carboxylic acid methyl ester