CAS 79472-22-3

4,5-Dihydro-6H-thieno[2,3-c]pyrrol-6-one

Description:

4,5-Dihydro-6H-thieno[2,3-c]pyrrol-6-one is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a thieno and pyrrole moiety. This compound features a five-membered ring containing sulfur and nitrogen atoms, contributing to its distinct chemical properties. It typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. The presence of the carbonyl group in the pyrrolone structure enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, this compound may exhibit biological activity, which has drawn interest in medicinal chemistry for potential applications in drug development. Its molecular structure allows for various substitutions, which can further modify its properties and reactivity. As with many heterocycles, it may participate in coordination with metal ions, influencing its behavior in different chemical environments. Overall, 4,5-Dihydro-6H-thieno[2,3-c]pyrrol-6-one represents a versatile scaffold in organic synthesis and medicinal chemistry.

Formula: C₆H₅NOS

InChI: InChI=1S/C6H5NOS/c8-6-5-4(3-7-6)1-2-9-5/h1-2H,3H2,(H,7,8)

InChI key: InChIKey=GIQBMQFTAUFJAW-UHFFFAOYSA-N

SMILES: O=C1C2=C(C=CS2)CN1

Synonyms:

• 4,5-Dihydrothieno[2,3-c]pyrrol-6-one
• 4H-Thieno[2,3-c]pyrrol-6(5H)-one
• 6H-Thieno[2,3-c]pyrrol-6-one, 4,5-dihydro-
• 4,5-Dihydro-6H-thieno[2,3-c]pyrrol-6-one

4H-Thieno[2,3-c]pyrrol-6(5H)-one

CAS: 79472-22-3

Formula: C₆H₅NOS

Color and Shape: Solid

Molecular weight: 139.1750

Ref: IN-DA00G72J

4,5-Dihydrothieno[2,3-c]pyrrol-6-one

CAS: 79472-22-3

4,5-Dihydrothieno[2,3-c]pyrrol-6-one is an organic compound that is used as a starting material for the synthesis of other compounds. It can be prepared by refluxing carbon tetrachloride and potassium carbonate in methanol solution with bromosuccinimide as an initiator. The yield of 4,5-dihydrothieno[2,3-c]pyrrol-6-one is about 60%.

Formula: C₆H₅NOS

Purity: Min. 95%

Molecular weight: 139.18 g/mol

Ref: 3D-EDA47222