CAS 79481-83-7

methyl 4-{4-[bis(2-chloroethyl)amino]phenyl}butanoate

Description:

Methyl 4-{4-[bis(2-chloroethyl)amino]phenyl}butanoate, with the CAS number 79481-83-7, is a synthetic organic compound that belongs to the class of esters. It features a butanoate moiety linked to a phenyl ring that is further substituted with a bis(2-chloroethyl)amino group, which is characteristic of certain anticancer agents. This compound exhibits properties typical of esters, such as being relatively non-volatile and having a moderate solubility in organic solvents. The presence of the bis(2-chloroethyl)amino group suggests potential biological activity, particularly in the context of its use in medicinal chemistry, where such groups are often associated with alkylating agents used in chemotherapy. The compound's structure indicates it may participate in nucleophilic substitution reactions due to the electrophilic nature of the chloroethyl groups. Overall, methyl 4-{4-[bis(2-chloroethyl)amino]phenyl}butanoate is of interest in both synthetic organic chemistry and pharmacology, particularly in the development of targeted cancer therapies.

Formula: C₁₅H₂₁Cl₂NO₂

InChI: InChI=1/C15H21Cl2NO2/c1-20-15(19)4-2-3-13-5-7-14(8-6-13)18(11-9-16)12-10-17/h5-8H,2-4,9-12H2,1H3

SMILES: COC(=O)CCCc1ccc(cc1)N(CCCl)CCCl

Synonyms:

• Methyl 4-(4-(Bis(2-Chloroethyl)Amino)Phenyl)Butyarte

Chlorambucil Methyl Ester

Controlled Product

CAS: 79481-83-7

Formula: C₁₅H₂₁Cl₂NO₂

Color and Shape: Neat

Molecular weight: 318.24

Ref: 86-MM0821.08

Chlorambucil Methylester

CAS: 79481-83-7

Formula: C₁₅H₂₁Cl₂NO₂

Molecular weight: 318.24

Ref: ST-EA-CP-C66010