CAS 79491-45-5
:2,6-Dibromo-3-methoxypyridine
Description:
2,6-Dibromo-3-methoxypyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two bromine atoms and a methoxy group. The presence of bromine atoms at the 2 and 6 positions contributes to its reactivity and potential applications in various chemical reactions, including electrophilic substitution. The methoxy group at the 3 position enhances the compound's solubility in organic solvents and can influence its electronic properties. This compound typically appears as a solid or liquid, depending on the specific conditions, and is often used in synthetic organic chemistry as an intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Its molecular structure allows for various interactions, making it a valuable building block in the development of more complex molecules. Safety precautions should be observed when handling this compound, as brominated compounds can pose health risks and environmental concerns.
Formula:C6H5Br2NO
InChI:InChI=1S/C6H5Br2NO/c1-10-4-2-3-5(7)9-6(4)8/h2-3H,1H3
InChI key:InChIKey=JFWDQTIVECPBDE-UHFFFAOYSA-N
SMILES:O(C)C1=C(Br)N=C(Br)C=C1
Synonyms:- 2,6-dibromo-3-Methoxypyridine
- Pyridine, 2,6-dibromo-3-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,6-Dibromo-3-methoxypyridine
CAS:Formula:C6H5Br2NOPurity:97%Color and Shape:SolidMolecular weight:266.91802,6-Dibromo-3-methoxypyridine
CAS:2,6-Dibromo-3-methoxypyridinePurity:97%Molecular weight:266.92g/mol2,6-Dibromo-3-methoxypyridine
CAS:Formula:C6H5Br2NOPurity:98%Color and Shape:SolidMolecular weight:266.922,6-Dibromo-3-methoxypyridine
CAS:2,6-Dibromo-3-methoxypyridine is an important intermediate for the synthesis of polymers and copolymers. It can be obtained by cross-coupling reactions with a variety of electrophiles such as alkyl halides and organometallic compounds. This compound can also be prepared by electrochemical synthesis in the presence of a suitable catalyst such as copper oxide or nickel oxide. The insoluble nature of 2,6-dibromo-3-methoxypyridine makes it difficult to isolate. 2,6-Dibromo-3-methoxypyridine is used in the preparation of thiophene, stannylated pyridines, and ethers. It has also been used in the synthesis of polymers and copolymers with a variety of monomers including styrene, vinyl acetate, acrylonitrile, methyl methacrylate, methyl acFormula:C6H5Br2NOPurity:Min. 95%Molecular weight:266.92 g/mol




