CymitQuimica logo

CAS 79491-47-7

:

2,6-Dibromo-5-methoxy-3-pyridinamine

Description:
2,6-Dibromo-5-methoxy-3-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of two bromine atoms at the 2 and 6 positions of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions, including electrophilic substitution. The methoxy group (-OCH3) at the 5 position enhances the compound's solubility in organic solvents and may influence its biological activity. As an amine, the compound features an amino group (-NH2) that can participate in hydrogen bonding and nucleophilic reactions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in the development of agrochemicals or pharmaceuticals. However, specific safety and handling guidelines should be followed due to the presence of bromine, which can be hazardous. Overall, 2,6-Dibromo-5-methoxy-3-pyridinamine is a versatile compound with significant implications in synthetic organic chemistry and drug development.
Formula:C6H6Br2N2O
InChI:InChI=1S/C6H6Br2N2O/c1-11-4-2-3(9)5(7)10-6(4)8/h2H,9H2,1H3
InChI key:InChIKey=OLOKVAYIUPHZEP-UHFFFAOYSA-N
SMILES:O(C)C1=C(Br)N=C(Br)C(N)=C1
Synonyms:
  • 3-Pyridinamine, 2,6-dibromo-5-methoxy-
  • 2,6-Dibromo-5-methoxy-3-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.