CAS 79491-49-9

5,6-Dimethoxy-3-pyridinamine

Description:

5,6-Dimethoxy-3-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features two methoxy groups (-OCH₃) attached to the 5 and 6 positions of the pyridine ring, and an amino group (-NH₂) at the 3 position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including medicinal chemistry and organic synthesis. The methoxy groups can enhance the compound's solubility and influence its electronic properties, while the amino group can participate in hydrogen bonding and nucleophilic reactions. 5,6-Dimethoxy-3-pyridinamine may exhibit biological activity, making it of interest for research in drug development. Its molecular structure allows for various modifications, which can lead to derivatives with altered pharmacological properties. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₇H₁₀N₂O₂

InChI: InChI=1S/C7H10N2O2/c1-10-6-3-5(8)4-9-7(6)11-2/h3-4H,8H2,1-2H3

InChI key: InChIKey=GWUSRFFXHVNXOZ-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C=C(N)C=N1

Synonyms:

• 2,3-Dimethoxy-5-aminopyridine
• 5,6-Dimethoxy-3-pyridinamine
• 3-Pyridinamine, 5,6-dimethoxy-

5,6-Dimethoxypyridin-3-amine

CAS: 79491-49-9

Formula: C₇H₁₀N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 154.1665

Ref: IN-DA0058KT

5-Amino-2,3-dimethoxypyridine

CAS: 79491-49-9

5-Amino-2,3-dimethoxypyridine

Purity: 95%

Color and Shape: Solid

Molecular weight: 154.17g/mol

Ref: 54-OR55347

5,6-Dimethoxypyridin-3-amine

CAS: 79491-49-9

5,6-Dimethoxypyridin-3-amine is an organic compound with the formula CHN. It is a versatile building block in organic chemistry. 5,6-Dimethoxypyridin-3-amine can be used as a reagent in the synthesis of other compounds or as a reactant to form new compounds. 5,6-Dimethoxypyridin-3-amine is soluble in organic solvents and reacts with most common electrophiles to give substituted products. 5,6-Dimethoxypyridin-3-amine has been found to be useful as an intermediate in the synthesis of a variety of natural products and pharmaceuticals.

Formula: C₇H₁₀N₂O₂

Purity: Min. 95%

Color and Shape: Purple Powder

Molecular weight: 154.17 g/mol

Ref: 3D-FD143719

5,6-Dimethoxypyridin-3-amine

CAS: 79491-49-9

Purity: 95%

Molecular weight: 154.1690063

Ref: 10-F660996