CAS 79495-84-4

8-HETE

Description:

8-HETE, or 8-hydroxyeicosatetraenoic acid, is a bioactive lipid derived from arachidonic acid, which is a polyunsaturated fatty acid. It is classified as a hydroxyeicosanoid, specifically an oxygenated derivative that plays a significant role in various physiological processes. 8-HETE is known for its involvement in inflammatory responses and has been studied for its potential effects on cell signaling pathways, particularly in relation to vascular biology and immune responses. The compound exhibits various biological activities, including promoting cell proliferation and influencing platelet aggregation. Its synthesis occurs through the action of lipoxygenases or cytochrome P450 enzymes, which introduce a hydroxyl group at the eighth carbon position of the eicosatetraenoic acid chain. Due to its role in mediating inflammatory processes, 8-HETE has garnered interest in research related to cardiovascular diseases, cancer, and other conditions where lipid mediators are implicated. As with many eicosanoids, the balance of its production and degradation is crucial for maintaining homeostasis in biological systems.

Formula: C₂₀H₃₂O₃

InChI: InChI=1/C20H32O3/c1-2-3-4-5-6-7-8-9-10-13-16-19(21)17-14-11-12-15-18-20(22)23/h6-7,9-11,13-14,16,19,21H,2-5,8,12,15,17-18H2,1H3,(H,22,23)/b7-6-,10-9-,14-11-,16-13+

InChI key: InChIKey=NLUNAYAEIJYXRB-HEJOTXCHNA-N

SMILES: C(C/C=C\CCCC(O)=O)(/C=C/C=C\C/C=C\CCCCC)O

Synonyms:

• (5Z,9E,11Z,14Z)-8-Hydroxy-5,9,11,14-eicosatetraenoic acid
• 5,9,11,14-Eicosatetraenoic acid, 8-hydroxy-, (5Z,9E,11Z,14Z)-
• 5,9,11,14-Eicosatetraenoic acid, 8-hydroxy-, (E,Z,Z,Z)-
• 5,9,11,14-Eicosatetraenoicacid, 8-hydroxy-, (E,Z,Z,Z)-
• 8-Hete

8-Hydroxy-5(Z),9(E),11(Z),14(Z)-eicosatetraenoic acid

CAS: 79495-84-4

8-Hydroxy-5(Z),9(E),11(Z),14(Z)-eicosatetraenoic acid is a leukotriene, which is a type of eicosanoid derived primarily from arachidonic acid. This compound is biosynthesized through the lipoxygenase pathway, which is a critical route for the production of various biologically active lipid mediators. The mode of action involves binding to specific cellular receptors and modulating inflammatory responses by amplifying the recruitment and activation of immune cells. It plays a significant role in the mediation and propagation of inflammatory diseases and is a crucial signaling molecule within the immune system.

Formula: C₂₀H₃₂O₃

Purity: Min. 95%

Molecular weight: 320.5 g/mol

Ref: 3D-EDA49584