CAS 79504-96-4

5-[(phenylsulfanyl)methyl]furan-2-carboxylic acid

Description:

5-[(Phenylsulfanyl)methyl]furan-2-carboxylic acid is an organic compound characterized by its furan ring, which is a five-membered aromatic heterocycle containing oxygen. The presence of a carboxylic acid functional group (-COOH) at the 2-position of the furan ring imparts acidic properties to the molecule, making it capable of donating protons in solution. The phenylsulfanyl group, attached to the 5-position via a methyl bridge, introduces a sulfur atom into the structure, which can influence the compound's reactivity and solubility. This compound may exhibit interesting biological activities due to the presence of both the furan and the phenylsulfanyl moieties, which can participate in various chemical interactions. Its unique structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment.

Formula: C₁₂H₁₀O₃S

InChI: InChI=1/C12H10O3S/c13-12(14)11-7-6-9(15-11)8-16-10-4-2-1-3-5-10/h1-7H,8H2,(H,13,14)

SMILES: c1ccc(cc1)SCc1ccc(C(=O)O)o1

Synonyms:

• 2-Furancarboxylic Acid, 5-[(Phenylthio)Methyl]-
• 5-[(Phenylsulfanyl)Methyl]-2-Furoic Acid

5-[(Phenylthio)methyl]-2-furoic acid

CAS: 79504-96-4

Versatile small molecule scaffold

Formula: C₁₂H₁₀O₃S

Purity: Min. 95%

Molecular weight: 234.27 g/mol

Ref: 3D-EDA50496