CAS 79513-35-2
:N-Boc-ethylenediamine hydrochloride
Description:
N-Boc-ethylenediamine hydrochloride is a chemical compound characterized by its structure, which includes a Boc (tert-butyloxycarbonyl) protecting group attached to an ethylenediamine backbone. This compound is typically used in organic synthesis, particularly in the preparation of various pharmaceuticals and biologically active molecules. The Boc group serves to protect the amine functionalities during chemical reactions, allowing for selective modifications. As a hydrochloride salt, it is soluble in water and exhibits stability under standard laboratory conditions. The presence of the hydrochloride form enhances its handling properties and solubility in polar solvents. N-Boc-ethylenediamine hydrochloride is often utilized in peptide synthesis and as a building block in the development of ligands and catalysts. Its reactivity can be attributed to the amine groups, which can participate in various chemical transformations, making it a versatile intermediate in synthetic chemistry. Safety precautions should be observed when handling this compound, as with many amines and their derivatives, due to potential irritant properties.
Formula:C7H17ClN2O2
InChI:InChI=1/C7H16N2O2.ClH/c1-7(2,3)11-6(10)9-5-4-8;/h4-5,8H2,1-3H3,(H,9,10);1H
SMILES:CC(C)(C)OC(=NCCN)O.Cl
Synonyms:- N-tert-Butoxycarbonyl-1,2-diaminoethane hydrochloride~tert-Butyl N-(2-aminoethyl)carbamate hydrochloride
- Tert-Butyl (2-Aminoethyl)Carbamate Hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-Boc-ethylenediamine hydrochloride, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H17ClN2O2Purity:98%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:196.68Carbamic acid, N-(2-aminoethyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1)
CAS:Formula:C7H17ClN2O2Purity:97%Color and Shape:SolidMolecular weight:196.6751tert-Butyl (2-aminoethyl)carbamate hydrochloride
CAS:tert-Butyl (2-aminoethyl)carbamate hydrochloridePurity:98%Molecular weight:196.678g/molN-Boc-Ethane-1,2-diamine hydrochloride
CAS:Formula:C7H17ClN2O2Purity:97%Color and Shape:SolidMolecular weight:196.68



