CAS 79516-82-8
:20-hydroxyleukotriene B4
Description:
20-Hydroxyleukotriene B4 (20-HETE) is a biologically active lipid mediator derived from arachidonic acid, primarily involved in inflammatory responses and various physiological processes. It is a metabolite of leukotriene B4, which is known for its role in immune responses and chemotaxis of leukocytes. The compound is characterized by its hydroxyl group at the 20th carbon position, which distinguishes it from other leukotrienes. 20-HETE is recognized for its involvement in regulating vascular tone, promoting angiogenesis, and influencing cell proliferation and apoptosis. It interacts with specific receptors and can modulate various signaling pathways, contributing to its effects in inflammation and cardiovascular health. Additionally, 20-HETE has been studied for its potential implications in various diseases, including hypertension and cancer. Its synthesis and degradation are tightly regulated, reflecting its importance in maintaining homeostasis within the body. As a research chemical, it is often used in studies exploring the mechanisms of inflammation and the therapeutic potential of targeting leukotriene pathways.
Formula:C20H32O5
InChI:InChI=1/C20H32O5/c21-17-10-6-2-1-3-7-12-18(22)13-8-4-5-9-14-19(23)15-11-16-20(24)25/h3-5,7-9,13-14,18-19,21-23H,1-2,6,10-12,15-17H2,(H,24,25)/b5-4+,7-3-,13-8+,14-9-/t18-,19-/m1/s1
InChI key:InChIKey=PTJFJXLGRSTECQ-PSPARDEHSA-N
SMILES:[C@@H](/C=C\C=C\C=C\[C@@H](C/C=C\CCCCCO)O)(CCCC(O)=O)O
Synonyms:- (5S,6Z,8E,10E,12R,14Z)-5,12,20-Trihydroxy-6,8,10,14-eicosatetraenoic acid
- (5S,6Z,8E,10E,12R,14Z)-5,12,20-trihydroxyicosa-6,8,10,14-tetraenoic acid
- 20-Hydroxy-LTB<sub>4</sub>
- 20-Hydroxyleukotriene B<sub>4</sub>
- 6,8,10,14-Eicosatetraenoic acid, 5,12,20-trihydroxy-, (5S,6Z,8E,10E,12R,14Z)-
- 6,8,10,14-Eicosatetraenoic acid, 5,12,20-trihydroxy-, [S-[R*,S*-(E,Z,E,Z)]]-
- ω-Hydroxy-LTB<sub>4</sub>
- 20-Hydroxy-LTB4
- 20-Hydroxyleukotriene B4
- PTJFJXLGRSTECQ-PSPARDEHSA-N
- (5R,12S,6Z,8E,10E,14Z)-5,12,20-Trihydroxy-6,8,10,14-icosatetraenoic acid
- 20-OH-LTB4
- 5S,12R,20-TRIHYDROXY-6Z,8E,10E,14Z-EICOSATETRAENOIC ACID
- hydroxyleukotriene B4
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
20-hydroxy Leukotriene B4
CAS:20-hydroxy LTB4, a LTB4 metabolite in neutrophils, is less active (~5%) but inhibits LTB4-induced degranulation, retains BLT2 affinity, non-agonist.
Formula:C20H32O5Color and Shape:SolidMolecular weight:352.47120-OH-LTB4
CAS:20-OH-LTB4 is a medicinal compound with potential anticancer properties. It has been shown to induce apoptosis in human and Chinese hamster ovary cells, making it a promising candidate for cancer treatment. 20-OH-LTB4 also inhibits the cell cycle by targeting kinases and other proteins involved in cancer cell growth. This compound has been identified as a potent inhibitor of urine-derived protein kinase, which plays a key role in cancer progression. In addition to its potential as an anticancer agent, 20-OH-LTB4 may have broader applications as a general inhibitor of kinases and other enzymes involved in cellular signaling pathways.Formula:C20H32O5Purity:Min. 95%Molecular weight:352.5 g/mol


