CAS 795260-68-3

3-[4-(benzyloxy)phenyl]-1H-pyrazole-5-carboxylic acid

Description:

3-[4-(Benzyloxy)phenyl]-1H-pyrazole-5-carboxylic acid is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a benzyloxy group attached to a phenyl ring enhances its lipophilicity and may influence its biological activity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components. Its CAS number, 795260-68-3, allows for precise identification in chemical databases. The compound's properties, such as solubility, melting point, and stability, would depend on the specific conditions and environment, making it essential for researchers to conduct empirical studies to fully understand its behavior in various applications. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research and development.

Formula: C₁₇H₁₄N₂O₃

InChI: InChI=1/C17H14N2O3/c20-17(21)16-10-15(18-19-16)13-6-8-14(9-7-13)22-11-12-4-2-1-3-5-12/h1-10H,11H2,(H,18,19)(H,20,21)

SMILES: c1ccc(cc1)COc1ccc(cc1)c1cc(C(=O)O)n[nH]1

Synonyms:

• 1H-pyrazole-3-carboxylic acid, 5-[4-(phenylmethoxy)phenyl]-
• 5-[4-(Benzyloxy)phenyl]-1H-pyrazole-3-carboxylic acid

5-(4-Benzyloxyphenyl)-1H-pyrazole-3-carboxylic acid

CAS: 795260-68-3

Formula: C₁₇H₁₄N₂O₃

Molecular weight: 294.3047

Ref: IN-DA008LXJ