CAS 79528-48-6
:[(2R,3S,4R,5R,6S)-3,4-diacetoxy-5-(1,3-dioxoisoindolin-2-yl)-6-methylsulfanyl-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(2R,3S,4R,5R,6S)-3,4-diacetoxy-5-(1,3-dioxoisoindolin-2-yl)-6-methylsulfanyl-tetrahydropyran-2-yl]methyl acetate" and CAS number 79528-48-6 is a complex organic compound characterized by its tetrahydropyran core structure, which is a six-membered ring containing one oxygen atom. This compound features multiple functional groups, including acetoxy groups, which are indicative of ester functionalities, and a methylthio group, suggesting the presence of sulfur. The presence of the isoindolin-2-yl moiety indicates potential biological activity, as isoindoline derivatives are often studied for their pharmacological properties. The stereochemistry of the molecule is specified by the R and S designations, which imply specific spatial arrangements of the atoms, potentially influencing its reactivity and interactions with biological targets. Overall, this compound's unique structure and functional groups may contribute to its chemical behavior and potential applications in medicinal chemistry or organic synthesis.
Formula:C21H23NO9S
InChI:InChI=1/C21H23NO9S/c1-10(23)28-9-15-17(29-11(2)24)18(30-12(3)25)16(21(31-15)32-4)22-19(26)13-7-5-6-8-14(13)20(22)27/h5-8,15-18,21H,9H2,1-4H3/t15-,16-,17-,18-,21+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside
CAS:Formula:C21H23NO9SPurity:98.0%Color and Shape:SolidMolecular weight:465.4736Methyl 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside
CAS:Formula:C21H23NO9SPurity:>98.0%(HPLC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:465.47Methyl 3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-b-D-thioglucopyranoside
CAS:<p>Methyl 3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-b-D-thioglucopyranoside (MTATP) is a drug that has been shown to be effective in treating pancreatitis and colitis. It has also shown promise as an anticancer agent. MTATP is a small molecule that inhibits the growth of cancer cells by inhibiting the enzyme phosphodiesterase 4B. This enzyme plays a role in the regulation of intracellular signaling pathways and is involved in cell proliferation and differentiation. MTATP has been shown to inhibit the activity of this enzyme, preventing cancer cells from proliferating and promoting their differentiation instead.</p>Formula:C21H23NO9SPurity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:465.47 g/mol



