CAS 79529-98-9
:6-fluoro-2-phenyl-1H-benzimidazole
Description:
6-Fluoro-2-phenyl-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a fluorine atom and a phenyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzimidazole moiety, which is known for its role in various pharmaceutical applications. The fluorine substitution can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. In terms of physical properties, it may be a solid at room temperature, with solubility varying based on the solvent used. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific diseases. Additionally, its CAS number, 79529-98-9, allows for easy identification and reference in chemical databases. Overall, 6-fluoro-2-phenyl-1H-benzimidazole represents a significant compound for research in both synthetic and medicinal chemistry.
Formula:C13H9FN2
InChI:InChI=1/C13H9FN2/c14-10-6-7-11-12(8-10)16-13(15-11)9-4-2-1-3-5-9/h1-8H,(H,15,16)
SMILES:c1ccc(cc1)c1nc2ccc(cc2[nH]1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.