CAS 795310-52-0
:4-(3,5-Dimethyl-4H-1,2,4-triazol-4-yl)piperidine
Description:
4-(3,5-Dimethyl-4H-1,2,4-triazol-4-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a triazole moiety. The presence of the 3,5-dimethyl substituents on the triazole ring contributes to its lipophilicity and potential biological activity. This compound is typically classified as a heterocyclic organic compound, and its molecular structure suggests it may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. The piperidine ring is known for its role in various biological activities, while the triazole group is often associated with antifungal and antimicrobial properties. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, and it may participate in various chemical reactions typical of nitrogen-containing heterocycles. Overall, 4-(3,5-Dimethyl-4H-1,2,4-triazol-4-yl)piperidine represents a class of compounds that could be of interest in drug development and other applications in the field of chemistry.
Formula:C11H18N2
InChI:InChI=1/C11H18N2/c1-9-3-4-10(2)13(9)11-5-7-12-8-6-11/h3-4,11-12H,5-8H2,1-2H3
SMILES:Cc1ccc(C)n1C1CCNCC1
Synonyms:- 4-(2,5-dimethyl-1H-pyrrol-1-yl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
