CAS 79538-22-0

1,3-difluoro-5-prop-2-en-1-ylbenzene

Description:

1,3-Difluoro-5-prop-2-en-1-ylbenzene, with the CAS number 79538-22-0, is an organic compound characterized by the presence of a benzene ring substituted with two fluorine atoms and a prop-2-en-1-yl group. The fluorine atoms are located at the 1 and 3 positions of the benzene ring, while the prop-2-en-1-yl group is attached at the 5 position, contributing to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit properties typical of both aromatic compounds and alkenes, such as stability due to resonance in the benzene ring and reactivity due to the double bond in the prop-2-en-1-yl group. The presence of fluorine can enhance the compound's lipophilicity and influence its interaction with biological systems, making it of interest in medicinal chemistry and materials science. Additionally, the compound's unique structure may lead to specific physical properties, such as boiling and melting points, which are influenced by the substituents on the benzene ring.

Formula: C₉H₈F₂

InChI: InChI=1/C9H8F2/c1-2-3-7-4-8(10)6-9(11)5-7/h2,4-6H,1,3H2

SMILES: C=CCc1cc(cc(c1)F)F

Synonyms:

• 1-Allyl-3,5-difluorobenzene
• Benzene, 1,3-difluoro-5-(2-propen-1-yl)-