
CAS 79557-60-1
:Benzoic acid, 2,4-dihydroxy-3-propyl-, methyl ester
Description:
Benzoic acid, 2,4-dihydroxy-3-propyl-, methyl ester, with CAS number 79557-60-1, is an organic compound characterized by its ester functional group derived from benzoic acid. This compound features a propyl group and two hydroxyl groups at the 2 and 4 positions of the benzene ring, contributing to its solubility and reactivity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of hydroxyl groups suggests potential for hydrogen bonding, which can influence its physical properties such as boiling point and solubility in polar solvents. This compound may exhibit antimicrobial and preservative properties, making it of interest in various applications, including food preservation and cosmetics. Its structure allows for potential interactions with biological systems, which could be relevant in pharmacological studies. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C11H14O4
InChI:InChI=1S/C11H14O4/c1-3-4-7-9(12)6-5-8(10(7)13)11(14)15-2/h5-6,12-13H,3-4H2,1-2H3
InChI key:InChIKey=WKUGLLRTMGGSPC-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(O)C(CCC)=C(O)C=C1
Synonyms:- Benzoic acid, 2,4-dihydroxy-3-propyl-, methyl ester
- Methyl 2,4-dihydroxy-3-propylbenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.