CAS 79560-74-0
:N-(4-methoxyphenyl)-2-(2-oxo-2H-indol-3-yl)hydrazinecarbothioamide
Description:
N-(4-methoxyphenyl)-2-(2-oxo-2H-indol-3-yl)hydrazinecarbothioamide, with the CAS number 79560-74-0, is a chemical compound that features a hydrazinecarbothioamide functional group, which is characterized by the presence of a hydrazine moiety linked to a thioamide. This compound also contains an indole structure, known for its aromatic properties and biological significance, as well as a methoxyphenyl group that enhances its lipophilicity and potential biological activity. The presence of the 2-oxo group contributes to its reactivity and may influence its interactions in biological systems. Generally, compounds of this nature are studied for their potential pharmacological properties, including anti-cancer and anti-inflammatory activities. The specific characteristics, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which the compound is analyzed. As with many organic compounds, the synthesis and characterization of this substance would involve techniques such as NMR, mass spectrometry, and chromatography to confirm its structure and purity.
Formula:C16H14N4O2S
InChI:InChI=1/C16H14N4O2S/c1-22-11-8-6-10(7-9-11)17-16(23)20-19-14-12-4-2-3-5-13(12)18-15(14)21/h2-9H,1H3,(H2,17,20,23)(H,18,19,21)
SMILES:COc1ccc(cc1)NC(=NN=C1c2ccccc2NC1=O)S
Synonyms:- (2E)-N-(4-Methoxyphenyl)-2-(2-oxo-1,2-dihydro-3H-indol-3-ylidene)hydrazinecarbothioamide
- Hydrazinecarbothioamide, 2-(1,2-dihydro-2-oxo-3H-indol-3-ylidene)-N-(4-methoxyphenyl)-, (2E)-
- hydrazinecarbothioamide, 2-(1,2-dihydro-2-oxo-3H-indol-3-ylidene)-N-(4-methoxyphenyl)-, (2Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
NSC73306
CAS:NSC73306 is a thiosemicarbazone known for its role as a cell-permeable agent, exhibiting increased toxicity towards cells expressing p-glycoprotein.Formula:C16H14N4O2SColor and Shape:SolidMolecular weight:326.373
