CymitQuimica logo

CAS 79560-92-2

:

L-Alanine, N-acetyl-3-sulfo-

Description:
L-Alanine, N-acetyl-3-sulfo- is a sulfonated derivative of the amino acid L-alanine, characterized by the presence of an acetyl group and a sulfonic acid group. This compound typically exhibits properties associated with amino acids, such as being soluble in water due to its polar functional groups. The acetyl group contributes to its stability and may influence its reactivity and interaction with biological systems. The sulfonic acid group enhances its solubility and can impart unique biological activities, making it of interest in various biochemical applications. L-Alanine itself is a non-essential amino acid involved in protein synthesis and metabolism. The modification with acetyl and sulfonic groups may affect its role in biological processes, potentially influencing enzyme activity or cellular signaling pathways. Overall, L-Alanine, N-acetyl-3-sulfo- represents a specialized compound with potential applications in pharmaceuticals, biochemistry, and research, particularly in studies related to amino acid metabolism and sulfonation effects.
Formula:C5H9NO6S
InChI:InChI=1S/C5H9NO6S/c1-3(7)6-4(5(8)9)2-13(10,11)12/h4H,2H2,1H3,(H,6,7)(H,8,9)(H,10,11,12)/t4-/m0/s1
InChI key:JOOZPRJIUKWLDM-BYPYZUCNSA-N
SMILES:CC(=O)N[C@@H](CS(=O)(=O)O)C(=O)O
Found 3 products.