CymitQuimica logo

CAS 79561-25-4

:

Boc-p-fluoro-DL-Phe-OH

Description:
Boc-p-fluoro-DL-Phe-OH, also known as Boc-p-fluorophenylalanine, is a derivative of the amino acid phenylalanine, characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group and a fluorine atom at the para position of the phenyl ring. This compound is typically used in peptide synthesis and medicinal chemistry due to its ability to introduce fluorine, which can enhance the biological activity and metabolic stability of peptides. The Boc group serves as a protective moiety that can be removed under acidic conditions, allowing for selective deprotection during synthesis. The presence of the fluorine atom can influence the compound's lipophilicity and hydrogen bonding capabilities, potentially affecting its interaction with biological targets. As a solid at room temperature, Boc-p-fluoro-DL-Phe-OH is generally stable under standard laboratory conditions but should be handled with care, following appropriate safety protocols. Its applications extend to research in drug design and development, particularly in the context of fluorinated compounds.
Formula:C14H18FNO4
InChI:InChI=1/C14H18FNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-4-6-10(15)7-5-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)
SMILES:CC(C)(C)OC(=NC(Cc1ccc(cc1)F)C(=O)O)O
Synonyms:
  • N-(tert-butoxycarbonyl)-4-fluorophenylalanine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.