CAS 79567-66-1
:(6-Chloro-3-pyridinyl)phenylmethanone
Description:
(6-Chloro-3-pyridinyl)phenylmethanone, with the CAS number 79567-66-1, is an organic compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom and a phenylmethanone moiety. This compound typically exhibits properties common to aromatic ketones, such as stability and moderate reactivity. The presence of the chloro group can influence its chemical behavior, potentially enhancing its electrophilic character and affecting its solubility in various solvents. It may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The compound is of interest in medicinal chemistry and material science due to its potential biological activity and applications in synthesizing other complex molecules. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C12H8ClNO
InChI:InChI=1S/C12H8ClNO/c13-11-7-6-10(8-14-11)12(15)9-4-2-1-3-5-9/h1-8H
InChI key:InChIKey=VYBSRFYWXHOQFR-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=CC(Cl)=NC1)C2=CC=CC=C2
Synonyms:- (6-Chloro-3-pyridinyl)phenylmethanone
- (6-Chloropyridin-3-yl)phenylmethanone
- 5-Benzoyl-2-chloropyridine
- Methanone, (6-Chloro-3-Pyridinyl)Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.