
CAS 79580-28-2
:Brevetoxin B
Description:
Brevetoxin B is a potent neurotoxin produced by certain species of dinoflagellates, particularly Karenia brevis, which is known for causing harmful algal blooms, commonly referred to as red tides. This compound is classified as a polyether and is characterized by its complex molecular structure, which includes multiple ether linkages and a cyclic arrangement. Brevetoxin B primarily affects the nervous system by binding to voltage-gated sodium channels, leading to prolonged depolarization of neurons and subsequent disruption of normal neuronal signaling. This mechanism can result in a range of toxic effects, including respiratory distress and gastrointestinal symptoms in humans and marine life. The substance is lipophilic, allowing it to accumulate in marine organisms, which can pose significant risks to human health through seafood consumption. Due to its toxicity, brevetoxin B is of considerable interest in environmental monitoring and public health, particularly in regions prone to algal blooms. Its CAS number, 79580-28-2, is used for identification in chemical databases and regulatory frameworks.
Formula:C50H70O14
InChI:InChI=1S/C50H70O14/c1-25(24-51)14-28-17-37(52)50(8)41(54-28)19-33-34(61-50)18-32-29(55-33)10-9-12-46(4)42(58-32)23-49(7)40(62-46)21-39-47(5,64-49)13-11-30-44(60-39)26(2)15-31-36(56-30)22-48(6)38(57-31)20-35-45(63-48)27(3)16-43(53)59-35/h9-10,16,24,26,28-42,44-45,52H,1,11-15,17-23H2,2-8H3/t26-,28-,29-,30+,31+,32+,33+,34-,35+,36-,37+,38-,39+,40-,41-,42-,44-,45-,46+,47-,48+,49+,50+/m1/s1
InChI key:InChIKey=LYTCVQQGCSNFJU-RXUQWMQDSA-N
SMILES:C[C@@]12[C@](O[C@]3(C)[C@@](C1)(O[C@@]4([C@@](C=CC3)(O[C@@]5([C@@](C4)(O[C@]6(C)[C@@](C5)(O[C@H](CC(C=O)=C)C[C@@H]6O)[H])[H])[H])[H])[H])[H])(C[C@]7([C@](C)(O2)CC[C@]8([C@](O7)([C@H](C)C[C@]9([C@](O8)(C[C@@]%10(C)[C@](O9)(C[C@]%11([C@](O%10)(C(C)=CC(=O)O%11)[H])[H])[H])[H])[H])[H])[H])[H])[H]
Synonyms:- Brevetoxin B
- 1H-Pyrano[2′′,3′′:5′,6′]pyrano[2′,3′:5,6]pyrano[3,2-b]pyrano[2′′′′′′,3′′′′′′:5′′′′′,6′′′′′]pyrano[2′′′′′,3′′′′′:5′′′′,6′′′′]pyrano[2′′′′,3′′′′:6′′′,7′′′]oxepino[2′′′,3′′′:6′′,7′′]oxepino[2′′,3′′:5′,6′]pyrano[2′,3′:5,6]pyrano[2,3-g]oxocin, brevetoxin B deriv.
- GB 2
- 1H-Pyrano[2′′,3′′:5′,6′]pyrano[2′,3′:5,6]pyrano[3,2-b]pyrano[2′′′′′′,3′′′′′′:5′′′′′,6′′′′′]pyrano[2′′′′′,3′′′′′:5′′′′,6′′′′]pyrano[2′′′′,3′′′′:6′′′,7′′′]oxepino[2′′′,3′′′:6′′,7′′]oxepino[2′′,3′′:5′,6′]pyrano[2′,3′:5,6]pyrano[2,3-g]oxocin-3-propanal, 2,3,4a,5,5a,6a,9,9a,10a,11,11a,12a,13,14,14a,15a,16,16a,18,20a,21a,22,22a,23a,24,25,25a,26a,27,27a,28a,29,29a,30a-tetratriacontahydro-1-hydroxy-9a,13,20,21a,25a,26a,30a-heptamethyl-α-methylene-18-oxo-, [1S-(1α,3α,4aα,5aα,6aα,9aα,10aα,11aα,12aα,13β,14aα,15aα,16aα,20aβ,21aβ,22aβ,23aβ,25aβ,26aβ,27aβ,28aβ,29aβ,30aβ)]-
- GB 2 (Gymnodinium)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Brevetoxin B
CAS:<p>Brevetoxin B, a polyketide neurotoxin from Karenia, affects sodium channels causing neurotoxic shellfish poisoning. IC50=15nM.</p>Formula:C50H70O14Color and Shape:SolidMolecular weight:895.096Brevetoxin PbTx-2
CAS:<p>Please enquire for more information about Brevetoxin PbTx-2 including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C50H70O14Molecular weight:895.09 g/mol

