CymitQuimica logo

CAS 79581-34-3

:

3-hydroxy-1-methyl-5-(pyridin-3-yl)pyrrolidin-2-one

Description:
3-Hydroxy-1-methyl-5-(pyridin-3-yl)pyrrolidin-2-one, with the CAS number 79581-34-3, is a chemical compound characterized by its pyrrolidinone structure, which includes a hydroxyl group and a methyl group at specific positions on the pyrrolidine ring. This compound features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The methyl group can affect the steric hindrance and electronic properties of the molecule. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for interactions with biological targets. Additionally, its unique combination of functional groups may impart specific pharmacological properties, making it a candidate for further research in drug development or as a biochemical probe. Overall, the characteristics of this compound suggest potential utility in various chemical and biological applications.
Formula:C10H12N2O2
InChI:InChI=1/C10H12N2O2/c1-12-8(5-9(13)10(12)14)7-3-2-4-11-6-7/h2-4,6,8-9,13H,5H2,1H3/t8-,9-/m0/s1
SMILES:CN1[C@@H](C[C@@H](C1=O)O)c1cccnc1
Synonyms:
  • 2-Pyrrolidinone, 3-hydroxy-1-methyl-5-(3-pyridinyl)-
  • (3S,5S)-3-hydroxy-1-methyl-5-(pyridin-3-yl)pyrrolidin-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.