CAS 79595-77-0

2,3-Butanediamine, hydrochloride (1:1)

Description:

2,3-Butanediamine, hydrochloride (1:1) is an organic compound characterized by its structure, which features two amine groups attached to a four-carbon chain. As a hydrochloride salt, it is typically encountered in a crystalline form and is soluble in water due to the presence of the hydrochloride group, which enhances its solubility compared to the free base. This compound is primarily used in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. It exhibits basic properties due to the amine groups, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, 2,3-butanediamine can act as a chiral building block in asymmetric synthesis, making it valuable in the development of enantiomerically pure compounds. Safety considerations include handling it with care, as amines can be irritants to the skin and respiratory system. Proper storage in a cool, dry place is recommended to maintain its stability and efficacy.

Formula: C₄H₁₂N₂·ClH

InChI: InChI=1S/C4H12N2.ClH/c1-3(5)4(2)6;/h3-4H,5-6H2,1-2H3;1H

InChI key: InChIKey=YJFWSHYYDTVDIC-UHFFFAOYSA-N

SMILES: C(C(C)N)(C)N.Cl

Synonyms:

• 2,3-Butanediamine, monohydrochloride
• 2,3-Butanediamine, hydrochloride (1:1)