CAS 796-29-2
:Ketipramine
Description:
Ketipramine, with the CAS number 796-29-2, is a chemical compound that belongs to the class of antidepressants known as tricyclic antidepressants (TCAs). It is characterized by its ability to inhibit the reuptake of neurotransmitters such as serotonin and norepinephrine, which are crucial in regulating mood and emotional responses. Ketipramine exhibits a range of pharmacological effects, including sedative and anxiolytic properties, making it useful in treating various mood disorders. The compound typically presents as a crystalline solid and is soluble in organic solvents. Its chemical structure features a tricyclic framework, which is common among TCAs, contributing to its therapeutic effects. As with many medications, ketipramine may have side effects, including sedation, weight gain, and anticholinergic effects, which can limit its use in certain populations. Due to its specific pharmacological profile, ketipramine is often prescribed with caution, considering potential interactions with other medications and individual patient factors.
Formula:C19H22N2O
InChI:InChI=1S/C19H22N2O/c1-20(2)12-7-13-21-17-10-5-3-8-15(17)14-19(22)16-9-4-6-11-18(16)21/h3-6,8-11H,7,12-14H2,1-2H3
InChI key:InChIKey=PXHIRIWYXDUSMR-UHFFFAOYSA-N
SMILES:C(CCN(C)C)N1C=2C(C(=O)CC=3C1=CC=CC3)=CC=CC2
Synonyms:- 10H-Dibenz[b,f]azepin-10-one, 5-[3-(dimethylamino)propyl]-5,11-dihydro-
- Ketimipramine
- GP 35259
- Ketoimipramine
- 5-[3-(Dimethylamino)propyl]-5,11-dihydro-10H-dibenz[b,f]azepin-10-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
