CAS 796-77-0
:[4-[2-(Diethylamino)ethoxy]phenyl]phenylmethanone
Description:
The chemical substance known as [4-[2-(Diethylamino)ethoxy]phenyl]phenylmethanone, with the CAS number 796-77-0, is an organic compound that belongs to the class of ketones and is characterized by its complex structure featuring both aromatic and aliphatic components. It typically exhibits a high degree of lipophilicity due to the presence of the diethylamino group, which can influence its solubility in organic solvents. This compound may demonstrate interesting photophysical properties, making it potentially useful in applications such as dyes, pigments, or in the field of organic electronics. Additionally, the presence of the diethylamino group suggests that it may have basic properties, allowing it to participate in various chemical reactions, including protonation and nucleophilic substitutions. Its molecular structure may also confer specific reactivity patterns, making it a candidate for further studies in medicinal chemistry or materials science. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C19H23NO2
InChI:InChI=1S/C19H23NO2/c1-3-20(4-2)14-15-22-18-12-10-17(11-13-18)19(21)16-8-6-5-7-9-16/h5-13H,3-4,14-15H2,1-2H3
InChI key:InChIKey=GSTOOYJSPRJGDO-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(OCCN(CC)CC)C=C1)C2=CC=CC=C2
Synonyms:- 4-(β-Diethylaminoethoxy)benzophenone
- Benzophenone, 4-[2-(diethylamino)ethoxy]-
- Methanone, [4-[2-(diethylamino)ethoxy]phenyl]phenyl-
- [2-(4-Benzoylphenoxy)ethyl]diethylamine
- [4-[2-(Diethylamino)ethoxy]phenyl]phenylmethanone
- {4-[2-(Diethylamino)Ethoxy]Phenyl}(Phenyl)Methanone
- 4-[2-(Diethylamino)ethoxy]benzophenone
- 4-(2-(Diethylamino)ethoxy)benzophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
(4-(2-(Diethylamino)ethoxy)phenyl)(phenyl)methanone
CAS:Formula:C19H23NO2Purity:97%Color and Shape:LiquidMolecular weight:297.3914(4-(2-(Diethylamino)ethoxy)phenyl)(phenyl)methanone
CAS:(4-(2-(Diethylamino)ethoxy)phenyl)(phenyl)methanonePurity:97%Molecular weight:297.4g/mol[4-[2-(Diethylamino)ethoxy]phenyl]phenylmethanone
CAS:Controlled ProductFormula:C19H23NO2Color and Shape:NeatMolecular weight:297.394-[2-(Diethylamino)ethoxy]benzophenone
CAS:Controlled ProductApplications Used in the preparation of antifertility agents.
References Das Gupta, A. et al.: Sci. Cult. 38, 480 (1967); Richardson, A. et al.: J. Med. Chem. 18, 689 (1975)Formula:C19H23NO2Color and Shape:NeatMolecular weight:297.39(4-(2-(Diethylamino)ethoxy)phenyl)(phenyl)methanone
CAS:Formula:C19H23NO2Purity:97%Color and Shape:Liquid, OilMolecular weight:297.3984-[2-(Diethylamino)ethoxy]benzophenone
CAS:Controlled Product4-[2-(Diethylamino)ethoxy]benzophenone is a biochemical that irreversibly inhibits the estrogen receptor. It has been shown to be an anti-estrogenic and anti-cancer agent in biochemical studies. 4-[2-(Diethylamino)ethoxy]benzophenone is metabolized by acetylation and interacts with other compounds, such as chlorination or chloride. This compound also interacts with tamoxifen and clomiphene, which are used for the treatment of breast cancer. 4-[2-(Diethylamino)ethoxy]benzophenone has been shown to inhibit estrogen-induced transcriptional activity in human breast cancer cells, suggesting that it may have therapeutic potential for the treatment of endometrial cancer.Formula:C19H23NO2Purity:Min. 95%Molecular weight:297.39 g/molClomiphene Benzophenone Analog ([4-[2-(Diethylamino)ethoxy]phenyl]phenylmethanone)
CAS:Amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters, salts thereof, nesoiFormula:C19H23NO2Color and Shape:Brown LiquidMolecular weight:297.17288









