CAS 79604-66-3
:2,4,6-Trimethyl-1,6-heptadien-4-ol
Description:
2,4,6-Trimethyl-1,6-heptadien-4-ol is an organic compound characterized by its structure, which includes a heptadiene backbone with three methyl groups and a hydroxyl group. This compound features a conjugated diene system, which can contribute to its reactivity and potential applications in organic synthesis. The presence of the hydroxyl group indicates that it is an alcohol, which can participate in hydrogen bonding, influencing its solubility and boiling point. Typically, compounds like this may exhibit interesting aromatic properties and can be used in the synthesis of various chemical intermediates or as flavoring agents due to their pleasant odor. The specific arrangement of the methyl groups and the position of the double bonds can affect the compound's stability and reactivity, making it a subject of interest in both synthetic and natural product chemistry. Additionally, its CAS number, 79604-66-3, allows for easy identification in chemical databases and literature.
Formula:C10H18O
InChI:InChI=1/C10H18O/c1-8(2)6-10(5,11)7-9(3)4/h11H,1,3,6-7H2,2,4-5H3
SMILES:C=C(C)CC(C)(CC(=C)C)O
Synonyms:- 2,4,6-Trimethylhepta-1,6-Dien-4-Ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,4,6-Trimethyl-1,6-heptadien-4-ol, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C10H18OPurity:98%Color and Shape:Clear colorless, LiquidMolecular weight:154.25


