CAS 79606-45-4

4-chloro-N,N-di(propan-2-yl)benzamide

Description:

4-Chloro-N,N-di(propan-2-yl)benzamide is an organic compound characterized by its amide functional group, which is derived from benzoic acid. The presence of a chlorine atom at the para position of the benzene ring contributes to its reactivity and potential applications in various chemical reactions. The two isopropyl groups attached to the nitrogen atom enhance the steric bulk of the molecule, which can influence its solubility and interaction with biological systems. This compound is likely to exhibit moderate polarity due to the amide bond, affecting its solubility in polar and non-polar solvents. Additionally, the presence of the chlorine atom may impart unique electronic properties, making it of interest in medicinal chemistry and material science. Its structural features suggest potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.

Formula: C₁₃H₁₈ClNO

InChI: InChI=1/C13H18ClNO/c1-9(2)15(10(3)4)13(16)11-5-7-12(14)8-6-11/h5-10H,1-4H3

SMILES: CC(C)N(C(C)C)C(=O)c1ccc(cc1)Cl

4-Chloro-N,N-diisopropylbenzamide

CAS: 79606-45-4

Formula: C₁₃H₁₈ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.7411

Ref: IN-DA005J9I

4-Chloro-N,N-diisopropylbenzamide

CAS: 79606-45-4

4-Chloro-N,N-diisopropylbenzamide

Formula: C₁₃H₁₈ClNO

Purity: ≥95%

Color and Shape: off-white solid

Molecular weight: 239.74g/mol

Ref: 54-OR59402

NSC 4810

CAS: 79606-45-4

NSC 4810

Purity: ≥98%

Molecular weight: 239.74g/mol

Ref: 54-BUP05915

NSC 4810

CAS: 79606-45-4

NSC 4810: an amide used with cytochrome P450 in vivo and acetylcholinesterase in vitro.

Formula: C₁₃H₁₈ClNO

Purity: 98.92%

Color and Shape: Solid

Molecular weight: 239.74

Ref: TM-T4631

4-Chloro-N,N-diisopropylbenzamide

CAS: 79606-45-4

Formula: C₁₃H₁₈ClNO

Purity: 98%

Molecular weight: 239.74

Ref: 10-F235957