CymitQuimica logo

CAS 796061-08-0

:

3-(p-Toluenesulfonylamino)benzeneboronic acid pinacol ester

Description:
3-(p-Toluenesulfonylamino)benzeneboronic acid pinacol ester is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl ring, which is further substituted with a p-toluenesulfonylamino group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols and other nucleophiles, making it useful in various organic synthesis applications, particularly in Suzuki coupling reactions. The pinacol ester moiety enhances its stability and solubility in organic solvents. Additionally, the presence of the p-toluenesulfonyl group can influence the compound's reactivity and solubility, often improving its utility in medicinal chemistry and material science. The compound is likely to be a white to off-white solid, and its reactivity can be modulated through the functional groups present, allowing for diverse applications in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C19H24BNO4S
InChI:InChI=1/C19H24BNO4S/c1-14-9-11-17(12-10-14)26(22,23)21-16-8-6-7-15(13-16)20-24-18(2,3)19(4,5)25-20/h6-13,21H,1-5H3
InChI key:RGAZOXRZFCGICF-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)S(=O)(=O)Nc1cccc(c1)B1OC(C)(C)C(C)(C)O1
Synonyms:
  • 4-methyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide
  • 3-(Toluene-4-Sulfonylamino)Phenylboronic Acid, Pinacol Ester
Found 4 products.