
CAS 796067-54-4
:(2-Amino-4,5,6,7-tetrahydro-6-methylbenzo[b]thien-3-yl)(3-methylphenyl)methanone
Description:
(2-Amino-4,5,6,7-tetrahydro-6-methylbenzo[b]thien-3-yl)(3-methylphenyl)methanone is a synthetic organic compound characterized by its complex structure, which includes a benzo[b]thien moiety and an amine functional group. This compound features a tetrahydro structure, indicating the presence of a saturated ring system, which contributes to its stability and potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. The methyl groups attached to the phenyl and tetrahydrobenzo[b]thien structures can enhance lipophilicity, potentially affecting its pharmacokinetic properties. This compound may exhibit interesting pharmacological activities, making it of interest in medicinal chemistry and drug development. Its specific interactions and effects would depend on its conformation and the presence of other functional groups, which can influence its binding affinity to biological targets. As with many synthetic compounds, safety and handling precautions should be observed, and its use should be guided by relevant regulatory standards.
Formula:C17H19NOS
InChI:InChI=1S/C17H19NOS/c1-10-4-3-5-12(8-10)16(19)15-13-7-6-11(2)9-14(13)20-17(15)18/h3-5,8,11H,6-7,9,18H2,1-2H3
InChI key:InChIKey=LVFUJBNKVVMXQX-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(SC1N)CC(C)CC2)C3=CC(C)=CC=C3
Synonyms:- (2-Amino-4,5,6,7-tetrahydro-6-methylbenzo[b]thien-3-yl)(3-methylphenyl)methanone
- Methanone, (2-amino-4,5,6,7-tetrahydro-6-methylbenzo[b]thien-3-yl)(3-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.