CymitQuimica logo

CAS 796067-65-7

:

2-[[(4-Bromophenyl)thio]methyl]-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidine

Description:
2-[[(4-Bromophenyl)thio]methyl]-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidine is a synthetic organic compound characterized by its complex structure, which includes a thieno[2,3-d]pyrimidine core. This compound features a thioether linkage with a 4-bromophenyl group, contributing to its potential reactivity and biological activity. The presence of chlorine and methyl groups on the pyrimidine ring enhances its lipophilicity and may influence its pharmacological properties. Typically, such compounds are of interest in medicinal chemistry due to their potential as therapeutic agents, particularly in the development of pharmaceuticals targeting various biological pathways. The molecular structure suggests that it may exhibit specific interactions with biological targets, making it a candidate for further investigation in drug discovery. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the aromatic and heterocyclic rings, which are crucial for its application in various chemical and biological contexts.
Formula:C15H12BrClN2S2
InChI:InChI=1S/C15H12BrClN2S2/c1-8-9(2)21-15-13(8)14(17)18-12(19-15)7-20-11-5-3-10(16)4-6-11/h3-6H,7H2,1-2H3
InChI key:InChIKey=VBPCFSSPZAEORP-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC(CSC3=CC=C(Br)C=C3)=N1)SC(C)=C2C
Synonyms:
  • 2-[[(4-Bromophenyl)thio]methyl]-4-chloro-5,6-dimethylthieno[2,3-d]pyrimidine
  • Thieno[2,3-d]pyrimidine, 2-[[(4-bromophenyl)thio]methyl]-4-chloro-5,6-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.