CAS 796071-90-4
:2-(5-fluoroindol-1-yl)acetic acid
Description:
2-(5-Fluoroindol-1-yl)acetic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 5-position of the indole ring contributes to its unique properties, potentially influencing its biological activity and reactivity. This compound features an acetic acid functional group, which imparts acidic characteristics and can participate in various chemical reactions, such as esterification or amidation. The molecular structure allows for potential interactions with biological targets, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the compound may exhibit specific pharmacological properties, which could be explored in medicinal chemistry. As with many indole derivatives, it may also show potential in various applications, including as a building block in organic synthesis or as a lead compound in drug discovery.
Formula:C10H8FNO2
InChI:InChI=1/C10H8FNO2/c11-8-1-2-9-7(5-8)3-4-12(9)6-10(13)14/h1-5H,6H2,(H,13,14)
SMILES:c1cc2c(ccn2CC(=O)O)cc1F
Synonyms:- (5-Fluoro-1H-indol-1-yl)acetic acid
- 1H-indole-1-acetic acid, 5-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
