CymitQuimica logo

CAS 79611-45-3

:

5′-Amino[2,3′-bipyridin]-6′(1′H)-one

Description:
5′-Amino[2,3′-bipyridin]-6′(1′H)-one, with the CAS number 79611-45-3, is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. This compound features an amino group at the 5' position and a keto group at the 6' position of the bipyridine framework, contributing to its reactivity and potential biological activity. The presence of the amino group enhances its solubility in polar solvents and allows for hydrogen bonding, which can influence its interactions in biological systems. The compound may exhibit properties such as fluorescence or chelation, making it of interest in various fields, including medicinal chemistry and materials science. Its structural characteristics suggest potential applications in drug development, particularly in targeting specific biological pathways or as a ligand in coordination chemistry. As with many organic compounds, its stability, reactivity, and potential toxicity would need to be evaluated in specific contexts to determine its suitability for various applications.
Formula:C10H9N3O
InChI:InChI=1S/C10H9N3O/c11-8-5-7(6-13-10(8)14)9-3-1-2-4-12-9/h1-6H,11H2,(H,13,14)
InChI key:InChIKey=OTIZLYDEBSAMGZ-UHFFFAOYSA-N
SMILES:NC1=CC(=CNC1=O)C2=CC=CC=N2
Synonyms:
  • 5′-Amino[2,3′-bipyridin]-6′(1′H)-one
  • 3-Amino-5-pyridin-2-yl-1H-pyridin-2-one
  • [2,3′-Bipyridin]-6′(1′H)-one, 5′-amino-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.