CymitQuimica logo

CAS 79615-80-8

:

1-{2-[(4-chlorobenzyl)oxy]phenyl}ethanone

Description:
1-{2-[(4-chlorobenzyl)oxy]phenyl}ethanone, with the CAS number 79615-80-8, is an organic compound characterized by its ketone functional group and ether linkage. This compound features a phenyl ring substituted with a 4-chlorobenzyl ether, which contributes to its unique chemical properties. The presence of the chlorine atom enhances the compound's reactivity and may influence its biological activity. Typically, compounds of this nature exhibit moderate to high lipophilicity due to the aromatic rings, which can affect their solubility in organic solvents. The ketone group is known for its ability to participate in various chemical reactions, including nucleophilic additions and reductions. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development or as a synthetic intermediate in organic synthesis. Overall, 1-{2-[(4-chlorobenzyl)oxy]phenyl}ethanone is a versatile compound with significant implications in both industrial and research settings.
Formula:C15H13ClO2
InChI:InChI=1/C15H13ClO2/c1-11(17)14-4-2-3-5-15(14)18-10-12-6-8-13(16)9-7-12/h2-9H,10H2,1H3
SMILES:CC(=O)c1ccccc1OCc1ccc(cc1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.