CAS 79623-38-4
:2,3-dibromo-5-(trifluoromethyl)pyridine
Description:
2,3-Dibromo-5-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 3 positions with bromine atoms and at the 5 position with a trifluoromethyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in pharmaceuticals and agrochemicals due to the presence of both halogen and trifluoromethyl groups, which can enhance biological activity and lipophilicity. The bromine substituents contribute to its reactivity, making it a useful intermediate in various chemical syntheses. Additionally, the trifluoromethyl group is known to impart unique electronic properties, influencing the compound's behavior in chemical reactions. Safety considerations are important when handling this substance, as it may pose health risks and environmental hazards. Proper storage and handling protocols should be followed to mitigate any potential risks associated with its use.
Formula:C6H2Br2F3N
InChI:InChI=1/C6H2Br2F3N/c7-4-1-3(6(9,10)11)2-12-5(4)8/h1-2H
SMILES:c1c(cnc(c1Br)Br)C(F)(F)F
Synonyms:- Pyridine, 2,3-Dibromo-5-(Trifluoromethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-Dibromo-5-(trifluoromethyl)pyridine, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H2Br2F3NPurity:95%Molecular weight:304.892,3-DIBROMO-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:Formula:C6H2Br2F3NPurity:95%Color and Shape:LiquidMolecular weight:304.89002,3-Dibromo-5-(trifluoromethyl)pyridine
CAS:<p>2,3-Dibromo-5-(trifluoromethyl)pyridine</p>Formula:C6H2Br2F3NPurity:95%Color and Shape: faint to light yellow liquidMolecular weight:304.89g/mol2,3-Dibromo-5-(trifluoromethyl)pyridine
CAS:Formula:C6H2Br2F3NPurity:95%Color and Shape:LiquidMolecular weight:304.892



