CAS 79623-39-5

2,5-Dibromo-3-(trifluoromethyl)pyridine

Description:

2,5-Dibromo-3-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 5 positions with bromine atoms and at the 3 position with a trifluoromethyl group. This compound is notable for its halogenated structure, which can influence its reactivity and interactions in various chemical processes. The presence of bromine atoms typically enhances the compound's electrophilicity, making it useful in synthetic organic chemistry, particularly in reactions involving nucleophiles. The trifluoromethyl group is known for imparting unique electronic properties, often increasing lipophilicity and altering the compound's biological activity. 2,5-Dibromo-3-(trifluoromethyl)pyridine may be utilized in the development of pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the compound. Safety precautions should be observed when handling this substance, as halogenated compounds can pose environmental and health risks.

Formula: C₆H₂Br₂F₃N

InChI: InChI=1S/C6H2Br2F3N/c7-3-1-4(6(9,10)11)5(8)12-2-3/h1-2H

InChI key: InChIKey=BPJRLWMELJRXLB-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(Br)N=CC(Br)=C1

Synonyms:

• 2,5-Dibromo-3-(trifluoromethyl)pyridine
• 2,5-Dibromo-3-trifluoromethylpyridine
• Pyridine, 2,5-dibromo-3-(trifluoromethyl)-

2,5-Dibromo-3-(trifluoromethyl)pyridine

CAS: 79623-39-5

Formula: C₆H₂Br₂F₃N

Purity: 97%

Color and Shape: Solid

Molecular weight: 304.8900

Ref: IN-DA008LVI

2,5-Dibromo-3-(trifluoromethyl)pyridine

CAS: 79623-39-5

2,5-Dibromo-3-(trifluoromethyl)pyridine

Purity: 97%

Molecular weight: 304.89g/mol

Ref: 54-PC100072

2,5-Dibromo-3-(trifluoromethyl)pyridine

CAS: 79623-39-5

Formula: C₆H₂Br₂F₃N

Purity: 97%

Color and Shape: Solid

Molecular weight: 304.892

Ref: 10-F234999