CAS 79624-37-6
:2-deoxy-2-(propanoylamino)-D-mannose
Description:
2-Deoxy-2-(propanoylamino)-D-mannose is a modified sugar derivative that features a deoxy group and an acylamino substituent. This compound is characterized by its structural composition, which includes a D-mannose backbone, a propanoyl group, and an amino functional group. The presence of the deoxy group indicates that one of the hydroxyl groups typically found in mannose has been replaced with a hydrogen atom, which can influence the compound's reactivity and biological activity. The propanoylamino group introduces a hydrophobic character, potentially affecting solubility and interaction with biological systems. This compound may exhibit unique properties in biochemical applications, particularly in glycosylation reactions or as a building block in the synthesis of more complex carbohydrates or glycoproteins. Its specific interactions and applications would depend on its stereochemistry and the context in which it is used, such as in drug development or as a biochemical probe. Overall, 2-deoxy-2-(propanoylamino)-D-mannose represents an interesting compound for research in carbohydrate chemistry and biochemistry.
Formula:C9H17NO6
InChI:InChI=1/C9H17NO6/c1-2-7(14)10-5(3-11)8(15)9(16)6(13)4-12/h3,5-6,8-9,12-13,15-16H,2,4H2,1H3,(H,10,14)/t5-,6-,8-,9-/m1/s1
SMILES:CCC(=N[C@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-Propanoyl mannosamine
CAS:<p>N-Propanoyl mannosamine is a biochemical that belongs to the group of glycoconjugates. It is an intracellular messenger that modulates the concentration of intracellular calcium and controls the release of gamma-aminobutyric acid (GABA). N-Propanoyl mannosamine has been shown to stimulate axonal growth in cell culture, which is mediated by the polysialic acid receptor. This molecule also has a role in human osteoblast differentiation and bone formation.<br>N-Propanoyl mannosamine can be synthesized from dopamine and erythrose via a series of reactions involving acidification, oxidation, reduction, and decarboxylation. The synthesis of this molecule requires blood group O as an acceptor.</p>Formula:C9H17NO6Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:235.23 g/mol
