CAS 79637-84-6
:(2,4-diaminophenyl)acetic acid
Description:
(2,4-Diaminophenyl)acetic acid, with the CAS number 79637-84-6, is an organic compound characterized by the presence of an acetic acid functional group attached to a phenyl ring that has two amino groups at the 2 and 4 positions. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid and amino groups, which can engage in hydrogen bonding. The amino groups contribute to its basicity, making it a potential candidate for various chemical reactions, including coupling reactions in organic synthesis. Additionally, the presence of multiple functional groups allows for diverse reactivity, making it useful in the development of pharmaceuticals and agrochemicals. Its structural features may also impart biological activity, which could be of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H10N2O2
InChI:InChI=1/C8H10N2O2/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4H,3,9-10H2,(H,11,12)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
