CAS 79638-54-3

4-(2-hydroxyphenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylic acid

Description:

4-(2-Hydroxyphenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylic acid, with the CAS number 79638-54-3, is a chemical compound characterized by its complex bicyclic structure, which includes an imidazopyridine core. This compound features a hydroxyl group attached to a phenyl ring, contributing to its potential biological activity and solubility properties. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, enhancing its interaction with biological systems. Its tetrahydro configuration suggests that it is a saturated derivative, which may influence its stability and reactivity. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, including anti-inflammatory or analgesic effects. However, specific applications and biological activities would require further investigation through experimental studies. Overall, the unique structural features of this compound make it a subject of interest in various fields, including organic synthesis and drug development.

Formula: C₁₃H₁₃N₃O₃

InChI: InChI=1/C13H13N3O3/c17-10-4-2-1-3-7(10)11-12-8(14-6-15-12)5-9(16-11)13(18)19/h1-4,6,9,11,16-17H,5H2,(H,14,15)(H,18,19)

SMILES: c1ccc(c(c1)C1c2c(CC(C(=O)O)N1)nc[nH]2)O

4-(2-Hydroxy-phenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylic acid

CAS: 79638-54-3

Purity: 95.0%

Molecular weight: 259.2650146484375

Ref: 10-F055093