CAS 79660-71-2
:6,8-difluoro-1-(2-fluoroethyl)-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid
Description:
6,8-Difluoro-1-(2-fluoroethyl)-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid is a synthetic compound belonging to the class of quinolines, which are known for their diverse biological activities. This particular compound features multiple fluorine substituents, which can enhance its lipophilicity and potentially influence its pharmacokinetic properties. The presence of a piperazine moiety suggests potential interactions with biological targets, particularly in the central nervous system or as an antimicrobial agent. The carboxylic acid functional group may contribute to its solubility in polar solvents and could play a role in its interaction with biological receptors. Additionally, the oxo group indicates the presence of a carbonyl functionality, which can be involved in various chemical reactions. Overall, the unique structural features of this compound may confer specific therapeutic properties, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its biological activity and potential applications.
Formula:C16H16F3N3O3
InChI:InChI=1/C16H16F3N3O3/c17-1-4-22-8-10(16(24)25)15(23)9-7-11(18)14(12(19)13(9)22)21-5-2-20-3-6-21/h7-8,20H,1-6H2,(H,24,25)
SMILES:C(Cn1cc(c(=O)c2cc(c(c(c12)F)N1CCNCC1)F)C(=O)O)F
Synonyms:- 3-Quinolinecarboxylic acid, 6,8-difluoro-1-(2-fluoroethyl)-1,4-dihydro-4-oxo-7-(1-piperazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.