CAS 796600-10-7
:2-Chloro-4-(4-piperidinyloxy)benzonitrile
Description:
2-Chloro-4-(4-piperidinyloxy)benzonitrile, identified by its CAS number 796600-10-7, is a chemical compound characterized by its aromatic structure, which includes a chloro substituent and a piperidinyloxy group attached to a benzonitrile framework. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the piperidine moiety suggests that it may interact with biological systems, potentially acting as a ligand or influencing pharmacological activity. The chloro group can enhance lipophilicity and may also participate in electrophilic substitution reactions. Additionally, the nitrile functional group contributes to the compound's polarity and can engage in hydrogen bonding or dipole interactions. Overall, 2-Chloro-4-(4-piperidinyloxy)benzonitrile is of interest in medicinal chemistry and may serve as a lead compound for further development in therapeutic applications.
Formula:C12H13ClN2O
InChI:InChI=1/C12H13ClN2O/c13-12-7-11(2-1-9(12)8-14)16-10-3-5-15-6-4-10/h1-2,7,10,15H,3-6H2
SMILES:c1cc(cc(c1C#N)Cl)OC1CCNCC1
Synonyms:- 2-Chloro-4-(Piperidin-4-Yloxy)Benzonitrile
- Benzonitrile, 2-Chloro-4-(4-Piperidinyloxy)-
- 2-Chloro-4-(4-Piperidyloxy)Benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
