CAS 79669-49-1
:2-METHYL-5-BROMOBENZOIC ACID
Description:
2-Methyl-5-bromobenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and a methyl group attached to a benzene ring. The molecular structure features a carboxylic acid functional group (-COOH) that imparts acidic properties, making it soluble in polar solvents like water and alcohols. The bromine substituent at the 5-position and the methyl group at the 2-position influence the compound's reactivity and physical properties, such as melting and boiling points. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Its reactivity can be attributed to the electron-withdrawing nature of the bromine atom, which can facilitate electrophilic substitution reactions. Additionally, the presence of both the bromine and carboxylic acid groups can enhance the compound's ability to participate in hydrogen bonding, affecting its solubility and interaction with biological systems. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H7BrO2
InChI:InChI=1/C8H7BrO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H,10,11)
SMILES:Cc1ccc(cc1C(=O)O)Br
Synonyms:- 5-Bromo-2-Methylbenzoic Acid
- 5-Bromo-2-Methyl-Benzoic Acid
- 5-Bromo-o-toluic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-Bromo-2-methylbenzoic Acid
CAS:Formula:C8H7BrO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:215.055-Bromo-2-methylbenzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H7BrO2Purity:97%Molecular weight:215.055-Bromo-2-methylbenzoic Acid
CAS:Formula:C8H7BrO2Purity:96%Color and Shape:SolidMolecular weight:215.04405-Bromo-2-methylbenzoic acid
CAS:Formula:C8H7BrO2Purity:97.0%Color and Shape:SolidMolecular weight:215.0465-Bromo-2-methylbenzoic acid
CAS:5-Bromo-2-methylbenzoic acidFormula:C8H7BrO2Purity:98%Color and Shape: white to off-white solidMolecular weight:215.04g/mol5-Bromo-2-methylbenzoic acid
CAS:Intermediate in the synthesis of canagliflozin
Formula:C8H7BrO2Purity:Min. 95%Color and Shape:White PowderMolecular weight:215.04 g/mol






