CAS 79670-17-0
:methyl 5-bromo-2-(bromomethyl)benzoate
Description:
Methyl 5-bromo-2-(bromomethyl)benzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety with bromine substituents. The presence of bromine atoms enhances its reactivity, making it useful in various chemical synthesis applications, particularly in the field of medicinal chemistry and material science. This compound features a methyl ester functional group, contributing to its solubility in organic solvents and its potential as a precursor in further chemical transformations. The bromomethyl group provides sites for nucleophilic substitution reactions, allowing for the introduction of diverse functional groups. Its molecular structure can influence its physical properties, such as melting and boiling points, as well as its reactivity patterns. Methyl 5-bromo-2-(bromomethyl)benzoate is typically handled with care due to the presence of bromine, which can pose health and environmental risks. As with many halogenated compounds, it is important to consider its behavior in biological systems and its potential environmental impact.
Formula:C9H8Br2O2
InChI:InChI=1/C9H8Br2O2/c1-13-9(12)8-4-7(11)3-2-6(8)5-10/h2-4H,5H2,1H3
SMILES:COC(=O)c1cc(ccc1CBr)Br
Synonyms:- Benzoic Acid, 5-Bromo-2-(Bromomethyl)-, Methyl Ester
- Methyl-5-brom-2-(brommethyl)benzoat
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
methyl 5-bromo-2-(bromomethyl)benzoate
CAS:Formula:C9H8Br2O2Purity:95%Color and Shape:SolidMolecular weight:307.9666Ref: IN-DA0036GC
1g47.00€5g111.00€10g145.00€25g206.00€50g541.00€100g573.00€250gTo inquire100mg27.00€250mg28.00€Methyl 5-bromo-2-(bromomethyl)benzoate
CAS:Methyl 5-bromo-2-(bromomethyl)benzoateFormula:C9H8Br2O2Purity:≥95%Color and Shape: pale yellow solidMolecular weight:307.97g/molMethyl 5-bromo-2-(bromomethyl)benzoate
CAS:Formula:C9H8Br2O2Purity:95%Color and Shape:LiquidMolecular weight:307.969Methyl 5-bromo-2-(bromomethyl)benzoate
CAS:Methyl 5-bromo-2-(bromomethyl)benzoate (5BMB) is a synthetic chemical that can be prepared by anionic bromination of methyl benzoate. The reaction proceeds with high efficiency and the product is obtained in good yields. 5BMB has been used as a target compound for X-ray diffraction studies, which have shown its structural properties.Formula:C9H8Br2O2Purity:Min. 95%Molecular weight:307.98 g/mol



