CAS 79672-27-8

2-Acetyl-N,N-dimethylbenzenesulfonamide

Description:

2-Acetyl-N,N-dimethylbenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is attached to a benzene ring. This compound features an acetyl group and two methyl groups on the nitrogen atom, contributing to its unique chemical properties. It is typically a white to off-white solid, soluble in polar organic solvents, and exhibits moderate stability under standard conditions. The presence of the sulfonamide group imparts potential biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and dipole-dipole interactions, which can influence its reactivity and solubility. Additionally, the compound may exhibit specific melting and boiling points, as well as distinct spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, 2-Acetyl-N,N-dimethylbenzenesulfonamide is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its functional groups and potential applications.

Formula: C₁₀H₁₃NO₃S

InChI: InChI=1S/C10H13NO3S/c1-8(12)9-6-4-5-7-10(9)15(13,14)11(2)3/h4-7H,1-3H3

InChI key: InChIKey=LQPAGUPRLDENBQ-UHFFFAOYSA-N

SMILES: S(N(C)C)(=O)(=O)C1=C(C(C)=O)C=CC=C1

Synonyms:

• 2-Acetyl-N,N-dimethylbenzenesulfonamide
• Benzenesulfonamide, 2-acetyl-N,N-dimethyl-
• 2-Acetyl-N,N-dimethylbenzene-1-sulfonamide