CymitQuimica logo

CAS 79678-37-8

:

Benzoic acid, 3-(phenylmethoxy)-, methyl ester

Description:
Benzoic acid, 3-(phenylmethoxy)-, methyl ester, also known by its CAS number 79678-37-8, is an organic compound characterized by its ester functional group. This compound features a benzoic acid moiety with a methoxy group attached to the phenyl ring, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the methoxy group enhances its solubility in organic solvents while potentially influencing its reactivity and stability. Benzoic acid derivatives are known for their applications in various fields, including pharmaceuticals, fragrances, and as intermediates in organic synthesis. The compound may exhibit moderate toxicity and should be handled with care, following appropriate safety protocols. Its chemical behavior can be influenced by factors such as pH, temperature, and the presence of other reactive species, making it a subject of interest in both academic and industrial research.
Formula:C15H14O3
InChI:InChI=1S/C15H14O3/c1-17-15(16)13-8-5-9-14(10-13)18-11-12-6-3-2-4-7-12/h2-10H,11H2,1H3
InChI key:VQEGUSMZKSIFJC-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC(=CC=C1)OCC2=CC=CC=C2
Found 4 products.