CAS 796845-58-4

2-(1-methyl-1H-pyrazol-4-yl)ethan-1-amine

Description:

2-(1-methyl-1H-pyrazol-4-yl)ethan-1-amine, with the CAS number 796845-58-4, is an organic compound characterized by its pyrazole ring structure, which contributes to its unique chemical properties. This compound features an amine functional group, making it a primary amine, and it is known for its potential biological activity, particularly in medicinal chemistry. The presence of the methyl group on the pyrazole ring enhances its lipophilicity, which can influence its interaction with biological targets. Additionally, the ethylamine side chain provides further functionalization opportunities, allowing for modifications that can enhance its pharmacological profile. The compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amine group. Its reactivity can be attributed to the amine functionality, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, 2-(1-methyl-1H-pyrazol-4-yl)ethan-1-amine is of interest in research for its potential applications in drug development and other chemical syntheses.

Formula: C₆H₁₁N₃

InChI: InChI=1S/C6H11N3/c1-9-5-6(2-3-7)4-8-9/h4-5H,2-3,7H2,1H3

SMILES: Cn1cc(CCN)cn1

1-(1-Methyl-1h-pyrazol-4-yl)ethanamine

CAS: 796845-58-4

Formula: C₆H₁₁N₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 125.1716

Ref: IN-DA008LNN

2-(1-Methyl-1H-pyrazol-4-yl)ethanamine

CAS: 796845-58-4

Formula: C₆H₁₁N₃

Purity: ≥97%

Color and Shape: Liquid

Molecular weight: 125.175

Ref: 10-F064549

2-(1-Methyl-1H-pyrazol-4-yl)ethanamine (~90%)

Controlled Product

CAS: 796845-58-4

Applications 2-(1-Methyl-1H-pyrazol-4-yl)ethanamine (cas# 796845-58-4) is a useful research chemical in the development of DNA-compatible methodology for generating novel highly functionalized imidazoles.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Geigle, S. N., et al.: Org. Lett., 21, 9001 (2019)

Formula: C₆H₁₁N₃

Purity: ~90%

Color and Shape: Neat

Molecular weight: 125.17

Ref: TR-M328068

2-(1-Methyl-1H-pyrazol-4-yl)ethanamine

CAS: 796845-58-4

Versatile small molecule scaffold

Formula: C₆H₁₁N₃

Purity: Min. 95%

Molecular weight: 125.18 g/mol

Ref: 3D-WGB84558