CAS 796851-03-1

2,5-Dichloro-4-iodopyridine

Description:

2,5-Dichloro-4-iodopyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with two chlorine atoms and one iodine atom. The molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. This compound is typically a solid at room temperature and may exhibit a pale yellow to brown color. It is soluble in organic solvents, such as dimethyl sulfoxide (DMSO) and acetone, but has limited solubility in water due to its hydrophobic nature. 2,5-Dichloro-4-iodopyridine is of interest in medicinal chemistry and material science, often serving as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its halogen substituents can enhance its reactivity, making it useful in various coupling reactions and as a building block for more complex molecules. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₅H₂Cl₂IN

InChI: InChI=1/C5H2Cl2IN/c6-3-2-9-5(7)1-4(3)8/h1-2H

SMILES: c1c(c(cnc1Cl)Cl)I

2,5-Dichloro-4-iodopyridine

CAS: 796851-03-1

Formula: C₅H₂Cl₂IN

Purity: 97%

Color and Shape: Solid

Molecular weight: 273.8865

Ref: IN-DA005INA

2,5-Dichloro-4-iodopyridine

CAS: 796851-03-1

Purity: 98%

Molecular weight: 273.887

Ref: FT-D13076

2,5-Dichloro-4-iodopyridine

CAS: 796851-03-1

2,5-Dichloro-4-iodopyridine

Formula: C₅H₂Cl₂IN

Purity: 97%

Color and Shape: white powder

Molecular weight: 273.89g/mol

Ref: 54-OR345414

2,5-Dichloro-4-iodopyridine

CAS: 796851-03-1

Formula: C₅H₂Cl₂IN

Purity: 95%

Color and Shape: Solid

Molecular weight: 273.88

Ref: 10-F069668