CymitQuimica logo

CAS 796963-32-1

:

3-Methylbicyclo[1.1.1]pentane-1-carbonitrile

Description:
3-Methylbicyclo[1.1.1]pentane-1-carbonitrile is a bicyclic organic compound characterized by its unique structure, which consists of a bicyclo[1.1.1]pentane framework with a methyl group and a carbonitrile functional group. The bicyclic structure contributes to its rigidity and distinctive chemical properties. The presence of the carbonitrile group (-C≡N) indicates that it has potential applications in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. This compound is likely to exhibit moderate polarity due to the electronegative nitrogen in the carbonitrile group, influencing its solubility in various solvents. Additionally, the methyl substitution can affect its reactivity and stability. As with many organic compounds, it is essential to handle it with care, considering potential toxicity and environmental impact. Overall, 3-Methylbicyclo[1.1.1]pentane-1-carbonitrile represents a fascinating example of bicyclic chemistry with implications in various fields of research and industry.
Formula:C7H9N
InChI:InChI=1S/C7H9N/c1-6-2-7(3-6,4-6)5-8/h2-4H2,1H3
InChI key:InChIKey=RNFOURVYTUHICP-UHFFFAOYSA-N
SMILES:C(#N)C12CC(C)(C1)C2
Synonyms:
  • Bicyclo[1.1.1]pentane-1-carbonitrile, 3-methyl-
  • 3-Methylbicyclo[1.1.1]pentane-1-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.