
CAS 796967-10-7
:N-[4-(3-Amino-1H-indazol-4-yl)phenyl]-N′-(3-methylphenyl)urea
Description:
N-[4-(3-Amino-1H-indazol-4-yl)phenyl]-N′-(3-methylphenyl)urea, identified by its CAS number 796967-10-7, is a chemical compound characterized by its urea functional group, which is linked to two distinct aromatic moieties. The presence of the indazole ring contributes to its potential biological activity, particularly in medicinal chemistry, where such structures are often explored for their pharmacological properties. The compound features an amino group, which can participate in hydrogen bonding, enhancing its solubility and reactivity. Additionally, the methylphenyl substituent may influence its lipophilicity and interaction with biological targets. This compound is typically synthesized through organic reactions involving urea derivatives and substituted phenyl groups. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the precise molecular interactions and the environment in which it is studied. Overall, this compound represents a class of molecules that may have applications in drug development, particularly in targeting specific biological pathways.
Formula:C21H19N5O
InChI:InChI=1S/C21H19N5O/c1-13-4-2-5-16(12-13)24-21(27)23-15-10-8-14(9-11-15)17-6-3-7-18-19(17)20(22)26-25-18/h2-12H,1H3,(H3,22,25,26)(H2,23,24,27)
InChI key:InChIKey=SPMHGQZFMNZCBV-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=CC=C2NN1)C3=CC=C(NC(NC4=CC(C)=CC=C4)=O)C=C3
Synonyms:- N-[4-(3-Amino-1H-indazol-4-yl)phenyl]-N′-(3-methylphenyl)urea
- Urea, N-[4-(3-amino-1H-indazol-4-yl)phenyl]-N′-(3-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.